@article{paperid:1023916, author = {Pourayoubi, Mehrdad and Tarahhomi, Atekeh and Arnold L. Rheingold and James A. Golen}, title = {N-(2,6-Difluorobenzoyl)-P,P-bis-(pyrrolidin-1-yl)phosphinic amide}, journal = {Acta Crystallographica Section E: Structure Reports Online}, year = {2011}, volume = {67}, number = {9}, month = {September}, issn = {1600-5368}, pages = {2444--2444}, numpages = {0}, keywords = {single-crystal X-ray study; T = 100 K; mean σ(C–C) = 0.003 Å; disorder in main residue; R factor = 0.047; wR factor = 0.119; data-to-parameter ratio = 16.4}, }