@article{paperid:1100178,
author = {Khorramaki, Maliheh and Pourayoubi, Mehrdad and Rezaei Yazdan Abad, Vahid and Darugar, Vahidreza and Vakili, Mohamad and واکلاو اینگر and مایکل دوسک},
title = {Supramolecular assembly mediated through NH···OX (X = C, N, P) hydrogen bonds and Y···π (Y = Br, π) contacts: Structural/computational studies of the P(O)(NHC(O)C6H4-3-NO2)(NHC6H4-3-Br)2 phosphoric triamide},
journal = {Journal of Molecular Structure},
year = {2025},
volume = {1321},
month = {February},
issn = {0022-2860},
pages = {140068--140081},
			numpages = {13},
keywords = {Phosphoric triamide; Noncovalent interaction; Hirshfeld surface analysis; DFT; NBO},
}